Product Detail
Product Tags
|
|
Product name: |
Sesamin |
Synonym: |
Asarinin; Episesamin; Fagarol; Sezamin |
Purity: |
98% + by HPLC |
Analysis Method: |
|
Identification Method: |
|
Appearance: |
White powder |
Chemical Family: |
Lignans |
Canonical SMILES: |
C1C2C(COC2C3=CC4=C(C=C3)OCO4)C(O1)C5=CC6=C(C=C5)OCO6 |
Botanical Source: |
Sideritis canariensis, the guggula resin from Commiphora mukul, Xanthoxylum spp. and Talauma hodgsoni. sesame oil. pyrethrum flowers (Chrysanthemum cinerariaefolium). Present in the Rutaceae, Piperaceae, Scrophulariacea |
Previous: Ciwujianoside B
Next: Neohesperidin