Product Detail
Product Tags
| |
|
| Product name： |
d-Tetrandrine |
| Synonym： |
Fanchinine, Sinomenine A |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
CN1CCC2=CC(=C3C=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Botanical Source： |
Root of Cocculus sarmentosus, Cyclea barbata, Cyclea peltata, Cyclea burmanni, Stephania hernandifolia, Triclisia subcordata and Isopyrum thalictroides, (Menispermaceae). Menisine obt. from the Chinese drug Mu fang chi (tubers of Steph |
Previous: Astragaloside IV
Next: Alkannin
