Product Detail
Product Tags
| |
|
| Product name： |
Aristolactam I |
| Synonym： |
Aristolactam |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
COC1=CC=CC2=C3C4=C(C=C21)NC(=O)C4=CC5=C3OCO5 |
| Botanical Source： |
Alkaloid from Root of Aristolochia argentina and Aristolochia indica, and from the tubers of Aristolochia rotunda, also Aristolochia debilis and the Chinese drug Fang-chi (Aristolochiaceae) |
Previous: Lappaconitine hydrobromide
Next: Butyl 4-Hydroxybenzoate
