Tsatanetsatane wa Zamalonda
Zolemba Zamalonda
| | |
| Dzina la malonda: | Aristolactam I |
| Mawu ofanana: | Aristolactam |
| Chiyero: | 98% + ndi HPLC |
| Analysis Njira: | |
| Chizindikiritso Njira: | |
| Mawonekedwe: | Ufa woyera |
| Chemical Family: | Alkaloids |
| Canonical SMILES: | COC1=CC=CC2=C3C4=C(C=C21)NC(=O)C4=CC5=C3OCO5 |
| Gwero la Botanical: | Alkaloid from Root of Aristolochia argentina and Aristolochia indica, and from the tubers of Aristolochia rotunda, also Aristolochia debilis and Chinese drug Fang-chi (Aristolochiaceae) |
Zam'mbuyo: Lappaconitine hydrobromide Ena: Butyl 4-Hydroxybenzoate
