Product Detail
Product Tags
| |
|
| Product name： |
Palmatine |
| Synonym： |
Berbericinine; Hindarinine |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
yellow powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
COC1C=CC2C=C3C4C=C(OC)C(=CC=4CC[N+]3=CC=2C=1OC)OC |
| Botanical Source： |
Quaternary alkaloid from Jateorhiza palmata (Menispermaceae) and a large number of other spp., mostly in Berberis and Mahonia (Berberidaceae), but spread into many families |
Previous: Rhapontigenin
Next: Next Post
