Product Detail
Product Tags
| |
|
| Product name： |
Obacunone |
| Synonym： |
Casimirolide; Tricoccin S3 |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Triterpenoids |
| Canonical SMILES： |
CC1(C)OC(=O)C=C[C@@]2(C)[C@H]1CC(=O)[C@]1(C)[C@@H]2CC[C@@]2(C)[C@@H](OC(=O)[C@H]3O[C@]213)C1=COC=C1 |
| Botanical Source： |
Citrus spp., Poncirus trifoliata, Fortunella margarita (oval kumquat), Casimiroa edulis (Mexican apple), Phellodendron spp. and others in the Rutaceae |
Previous: Syringic acid
Next: Norisoboldine
