Product Detail
Product Tags
| |
|
| Product name： |
Cepharanthine |
| Synonym： |
12-O-Methylcepharanoline |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Alkaloids |
| Canonical SMILES： |
CN1CCC2C=C(OC)C3=CC=2[C@@H]1CC1C=C(OC2C=CC(C[C@@H]4C5C(O3)=C3OCOC3=CC=5CCN4C)=CC=2)C(=CC=1)OC |
| Botanical Source： |
the root tubers of Stephania cepharantha and Stephania erecta, and from Root of Stephania sasakii and Stephania epigeae (Menispermaceae) |
Previous: Talatisamine
Next: Curdione
