Lintlha tsa Sehlahisoa
Li-tag tsa Sehlahisoa
| | |
| Lebitso la sehlahisoa: | plumbapin |
| Synonym: | Ophioxylin |
| Bohloeki: | 98% + ka HPLC |
| Mokhoa oa ho sekaseka: | |
| Mokhoa oa ho Itseba: | |
| Ponahalo: | |
| Lelapa la Lik'hemik'hale: | |
| Canonical SMILES: | CC1=CC(=O)C2C(O)=CC=CC=2C1=O |
| Mohloli oa Limela: | tse fapa-fapaneng Plumbago spp., Dyerophytum africanum, Drosera congolana, many Diospyros spp., Dioncophyllum thollonii, Nepenthes rafflesiana, Aristea ecklonii and other Aristea spp., Sisyrinchium californicum and Sparaxis tricolor |
E fetileng: Norcimifugin E 'ngoe: Sakuranetin
