| Product name： | Wogonin |
| Synonym： | Vogonin |
| Purity： | 98% + by HPLC |
| Appearance： | Yellow powder |
| Chemical Family： | Flavonoids |
| Canonical SMILES： | COC1C2OC(=CC(=O)C=2C(O)=CC=1O)C1C=CC=CC=1 |
| Botanical Source： | roots of Scutellaria baicalensis and from other plants |
| Product name： | Wogonin |
| Synonym： | Vogonin |
| Purity： | 98% + by HPLC |
| Appearance： | Yellow powder |
| Chemical Family： | Flavonoids |
| Canonical SMILES： | COC1C2OC(=CC(=O)C=2C(O)=CC=1O)C1C=CC=CC=1 |
| Botanical Source： | roots of Scutellaria baicalensis and from other plants |