Product Detail
Product Tags
| |
|
| Product name： |
Usnic acid |
| Synonym： |
Usninic acid; Carbonusninic acid |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
|
| Chemical Family： |
|
| Canonical SMILES： |
CC(=O)C1C2OC3=CC(=O)C(C(=O)C3(C)C=2C(O)=C(C)C=1O)C(C)=O |
| Botanical Source： |
A widely distributed lichen acid, found in Usnea, Ramalina, Evernia, Parmelia, Lecanora, Nephroma, Cetraria, Cladonia, Placodium, Alectoria and Haematomma spp. Found as both enantiomers and the racemate, with enantiomers not always distinguished. Found o |
Previous: Troxerutin
Next: Acetovanillone
