Product Detail
Product Tags
| |
|
| Product name： |
Levodopa |
| Synonym： |
3,4-Dihydroxy-L-phenylalanine;Bendopa; Brocadopa; Dopar; Larodopa |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
White powder |
| Chemical Family： |
Phenylpropanoids |
| Canonical SMILES： |
C1=CC(=C(C=C1CC(C(=O)O)N)O)O |
| Botanical Source： |
Occurs in seedlings and pods of Vicia faba, in Mucuna pruriens, Sarothamnus scoparius, Stizolobium deeringianum, Stizolobium hassjoo, Aristolochia clematitis and other plants. Also prod. by Bacillus spp. |
Previous: Ciwujianoside B
Next: Neohesperidin
