Product Detail
Product Tags
| |
|
| Product name： |
Isopimpinellin |
| Synonym： |
4,9-Dimethoxypsoralen |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
pale yellow powder |
| Chemical Family： |
Coumarins |
| Canonical SMILES： |
COC1C2OC=CC=2C(OC)=C2C=CC(=O)OC2=1 |
| Botanical Source： |
Present in roots of Pimpinella saxifraga and Heracleum spp., leaves of Skimmia laureola, root bark of Feronia elephantum, Ruta pinnata, Angelica archangelica, Pastinaca spp. and other plants |
Previous: Tomatine
Next: Adenine
