Product Detail
Product Tags
| |
|
| Product name： |
Hesperidin |
| Synonym： |
Citrus-hesperidin; Cirontin; Vitamin B; Cirantin; Hesperidoside; Hesperetin 7-rutinoside; Atripliside B |
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Off-white powder |
| Chemical Family： |
Flavonoids |
| Canonical SMILES： |
CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O)O |
| Botanical Source： |
Found in most citrus fruits and other members of the Rutaceae, also in Mentha longifolia, Vernonia, Anthurium, Xanthoxylum spp. and many others. First oranges in 1828 |
Previous: Emodin
Next: Paeonol
