| |
|
| CAS No： |
136085-37-5 |
| Catalog No： |
JOT-10002 |
| Chemical Formula： |
C20H28O8 |
| Molecular Weight： |
396.436 |
| Purity（by HPLC）: |
95%～99% |
| Pack size |
Stock |
Price |
Quantity |
|
Packaging: Packaging could be tailored as per customers’ request.
Shipping: Shipped via FedEx, DHL, EMS and so on. |
| |
|
| Product name： |
Lobetyolin |
| Synonym： |
|
| Purity： |
98% + by HPLC |
| Analysis Method： |
|
| Identification Method： |
|
| Appearance： |
Yellow powder |
| Chemical Family： |
Glycosides |
| Canonical SMILES： |
CC=CC#CC#CC(C(C=CCCCO)OC1C(C(C(C(O1)CO)O)O)O)O |
| Botanical Source： |
Codonopsis pilosula(Franch.)Nannf. |
|
